C20H22F2O6 — CID 134574763
(4S,6E,9R,10S,12E)-15,15-difluoro-9,10-dihydroxy-16-methoxy-4-methyl-8-methylidene-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,16-tetraene-2,18-dione (PubChem CID 134574763) has the molecular formula C20H22F2O6 and a molecular weight of 396.39 g/mol. Its IUPAC name is (4S,6E,9R,10S,12E)-15,15-difluoro-9,10-dihydroxy-16-methoxy-4-methyl-8-methylidene-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,16-tetraene-2,18-dione.
| Compound Name | (4S,6E,9R,10S,12E)-15,15-difluoro-9,10-dihydroxy-16-methoxy-4-methyl-8-methylidene-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,16-tetraene-2,18-dione |
|---|---|
| PubChem CID | 134574763 |
| Molecular Formula | C20H22F2O6 |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | (4S,6E,9R,10S,12E)-15,15-difluoro-9,10-dihydroxy-16-methoxy-4-methyl-8-methylidene-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,16-tetraene-2,18-dione |
| SMILES | C=C1/C=C/C[C@H](C)OC(=O)C2=C(/C=C/C[C@H](O)[C@@H]1O)C(F)(F)C(OC)=CC2=O |
| InChI | InChI=1S/C20H22F2O6/c1-11-6-4-7-12(2)28-19(26)17-13(8-5-9-14(23)18(11)25)20(21,22)16(27-3)10-15(17)24/h4-6,8,10,12,14,18,23,25H,1,7,9H2,2-3H3/b6-4+,8-5+/t12-,14-,18+/m0/s1 |
| InChIKey | KTPVNAHYWUJBJV-LIHRZDPUSA-N |
| XLogP | 2.15 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|