C20H22F2O7 — CID 134574765
(2R,4R,6S,7R,9E,12S)-19,19-difluoro-6,7-dihydroxy-18-methoxy-12-methyl-8-methylidene-3,13-dioxatricyclo[13.4.0.02,4]nonadeca-1(15),9,17-triene-14,16-dione (PubChem CID 134574765) has the molecular formula C20H22F2O7 and a molecular weight of 412.39 g/mol. Its IUPAC name is (2R,4R,6S,7R,9E,12S)-19,19-difluoro-6,7-dihydroxy-18-methoxy-12-methyl-8-methylidene-3,13-dioxatricyclo[13.4.0.02,4]nonadeca-1(15),9,17-triene-14,16-dione.
| Compound Name | (2R,4R,6S,7R,9E,12S)-19,19-difluoro-6,7-dihydroxy-18-methoxy-12-methyl-8-methylidene-3,13-dioxatricyclo[13.4.0.02,4]nonadeca-1(15),9,17-triene-14,16-dione |
|---|---|
| PubChem CID | 134574765 |
| Molecular Formula | C20H22F2O7 |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | (2R,4R,6S,7R,9E,12S)-19,19-difluoro-6,7-dihydroxy-18-methoxy-12-methyl-8-methylidene-3,13-dioxatricyclo[13.4.0.02,4]nonadeca-1(15),9,17-triene-14,16-dione |
| SMILES | C=C1/C=C/C[C@H](C)OC(=O)C2=C([C@H]3O[C@@H]3C[C@H](O)[C@@H]1O)C(F)(F)C(OC)=CC2=O |
| InChI | InChI=1S/C20H22F2O7/c1-9-5-4-6-10(2)28-19(26)15-11(23)8-14(27-3)20(21,22)16(15)18-13(29-18)7-12(24)17(9)25/h4-5,8,10,12-13,17-18,24-25H,1,6-7H2,2-3H3/b5-4+/t10-,12-,13+,17+,18-/m0/s1 |
| InChIKey | NWFUCHDNGMEWHH-MKPFEGKSSA-N |
| XLogP | 1.36 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|