C11H14F4N5O2S+ — CID 134574980
2-[(4-azido-2,3,5,6-tetrafluorophenyl)sulfonylamino]ethyl-trimethylazanium (PubChem CID 134574980) has the molecular formula C11H14F4N5O2S+ and a molecular weight of 356.33 g/mol. Its IUPAC name is 2-[(4-azido-2,3,5,6-tetrafluorophenyl)sulfonylamino]ethyl-trimethylazanium.
| Compound Name | 2-[(4-azido-2,3,5,6-tetrafluorophenyl)sulfonylamino]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 134574980 |
| Molecular Formula | C11H14F4N5O2S+ |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 2-[(4-azido-2,3,5,6-tetrafluorophenyl)sulfonylamino]ethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCNS(=O)(=O)c1c(F)c(F)c(N=[N+]=[N-])c(F)c1F |
| InChI | InChI=1S/C11H14F4N5O2S/c1-20(2,3)5-4-17-23(21,22)11-8(14)6(12)10(18-19-16)7(13)9(11)15/h17H,4-5H2,1-3H3/q+1 |
| InChIKey | FNCMVDNWVCOWKG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 94.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|