C20H18FN7O2 — CID 134575060
3-[1-[(2-fluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]-5,5-dimethyl-6,7-dihydropyrrolo[3,2-e][1,2,4]triazin-6-ol (PubChem CID 134575060) has the molecular formula C20H18FN7O2 and a molecular weight of 407.41 g/mol. Its IUPAC name is 3-[1-[(2-fluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]-5,5-dimethyl-6,7-dihydropyrrolo[3,2-e][1,2,4]triazin-6-ol.
| Compound Name | 3-[1-[(2-fluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]-5,5-dimethyl-6,7-dihydropyrrolo[3,2-e][1,2,4]triazin-6-ol |
|---|---|
| PubChem CID | 134575060 |
| Molecular Formula | C20H18FN7O2 |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 3-[1-[(2-fluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]-5,5-dimethyl-6,7-dihydropyrrolo[3,2-e][1,2,4]triazin-6-ol |
| SMILES | CC1(C)c2nc(-c3cc(-c4ccon4)n(Cc4ccccc4F)n3)nnc2NC1O |
| InChI | InChI=1S/C20H18FN7O2/c1-20(2)16-18(23-19(20)29)25-24-17(22-16)14-9-15(13-7-8-30-27-13)28(26-14)10-11-5-3-4-6-12(11)21/h3-9,19,29H,10H2,1-2H3,(H,23,25) |
| InChIKey | YKSNICMHOYPAIF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |