C10H18F4O6 — CID 134575844
3-[4-(2,3-dihydroxypropoxy)-2,2,3,3-tetrafluorobutoxy]propane-1,2-diol (PubChem CID 134575844) has the molecular formula C10H18F4O6 and a molecular weight of 310.24 g/mol. Its IUPAC name is 3-[4-(2,3-dihydroxypropoxy)-2,2,3,3-tetrafluorobutoxy]propane-1,2-diol.
| Compound Name | 3-[4-(2,3-dihydroxypropoxy)-2,2,3,3-tetrafluorobutoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 134575844 |
| Molecular Formula | C10H18F4O6 |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 3-[4-(2,3-dihydroxypropoxy)-2,2,3,3-tetrafluorobutoxy]propane-1,2-diol |
| SMILES | OCC(O)COCC(F)(F)C(F)(F)COCC(O)CO |
| InChI | InChI=1S/C10H18F4O6/c11-9(12,5-19-3-7(17)1-15)10(13,14)6-20-4-8(18)2-16/h7-8,15-18H,1-6H2 |
| InChIKey | GJZFCXNWPHXBDZ-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|