C10H12N4 — CID 134576476
3-methyl-1,4,8,10-tetrazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene (PubChem CID 134576476) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is 3-methyl-1,4,8,10-tetrazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene.
| Compound Name | 3-methyl-1,4,8,10-tetrazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene |
|---|---|
| PubChem CID | 134576476 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 3-methyl-1,4,8,10-tetrazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene |
| SMILES | CC1NCCc2nc3ncccn3c21 |
| InChI | InChI=1S/C10H12N4/c1-7-9-8(3-5-11-7)13-10-12-4-2-6-14(9)10/h2,4,6-7,11H,3,5H2,1H3 |
| InChIKey | RQNITGLBZURJPX-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |