C22H42F3N3 — CID 134576589
1-(2,3-dimethylbutan-2-yl)-4-[4-[4-methyl-1-(2,2,2-trifluoroethyl)piperidin-4-yl]butyl]piperazine (PubChem CID 134576589) has the molecular formula C22H42F3N3 and a molecular weight of 405.59 g/mol. Its IUPAC name is 1-(2,3-dimethylbutan-2-yl)-4-[4-[4-methyl-1-(2,2,2-trifluoroethyl)piperidin-4-yl]butyl]piperazine.
| Compound Name | 1-(2,3-dimethylbutan-2-yl)-4-[4-[4-methyl-1-(2,2,2-trifluoroethyl)piperidin-4-yl]butyl]piperazine |
|---|---|
| PubChem CID | 134576589 |
| Molecular Formula | C22H42F3N3 |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.33 |
| IUPAC Name | 1-(2,3-dimethylbutan-2-yl)-4-[4-[4-methyl-1-(2,2,2-trifluoroethyl)piperidin-4-yl]butyl]piperazine |
| SMILES | CC(C)C(C)(C)N1CCN(CCCCC2(C)CCN(CC(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C22H42F3N3/c1-19(2)20(3,4)28-16-14-26(15-17-28)11-7-6-8-21(5)9-12-27(13-10-21)18-22(23,24)25/h19H,6-18H2,1-5H3 |
| InChIKey | GSFLJMFCZVNPRW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|