C21H44N2O — CID 134576593
2-N,6-N,6-N-triethyl-2,3,6,7-tetramethyl-2-N-(oxetan-3-yl)octane-2,6-diamine (PubChem CID 134576593) has the molecular formula C21H44N2O and a molecular weight of 340.60 g/mol. Its IUPAC name is 2-N,6-N,6-N-triethyl-2,3,6,7-tetramethyl-2-N-(oxetan-3-yl)octane-2,6-diamine.
| Compound Name | 2-N,6-N,6-N-triethyl-2,3,6,7-tetramethyl-2-N-(oxetan-3-yl)octane-2,6-diamine |
|---|---|
| PubChem CID | 134576593 |
| Molecular Formula | C21H44N2O |
| Molecular Weight | 340.60 g/mol |
| Exact Mass | 340.35 |
| IUPAC Name | 2-N,6-N,6-N-triethyl-2,3,6,7-tetramethyl-2-N-(oxetan-3-yl)octane-2,6-diamine |
| SMILES | CCN(C1COC1)C(C)(C)C(C)CCC(C)(C(C)C)N(CC)CC |
| InChI | InChI=1S/C21H44N2O/c1-10-22(11-2)21(9,17(4)5)14-13-18(6)20(7,8)23(12-3)19-15-24-16-19/h17-19H,10-16H2,1-9H3 |
| InChIKey | WMXPBNOQNKGKGF-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.60 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |