C26H31FN6O — CID 134576902
2-[2-[3-(2-fluoroethylamino)-1-phenylpropoxy]phenyl]-N,N,3,4-tetramethylpyrazolo[3,4-d]pyridazin-7-amine (PubChem CID 134576902) has the molecular formula C26H31FN6O and a molecular weight of 462.57 g/mol. Its IUPAC name is 2-[2-[3-(2-fluoroethylamino)-1-phenylpropoxy]phenyl]-N,N,3,4-tetramethylpyrazolo[3,4-d]pyridazin-7-amine.
| Compound Name | 2-[2-[3-(2-fluoroethylamino)-1-phenylpropoxy]phenyl]-N,N,3,4-tetramethylpyrazolo[3,4-d]pyridazin-7-amine |
|---|---|
| PubChem CID | 134576902 |
| Molecular Formula | C26H31FN6O |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | 2-[2-[3-(2-fluoroethylamino)-1-phenylpropoxy]phenyl]-N,N,3,4-tetramethylpyrazolo[3,4-d]pyridazin-7-amine |
| SMILES | Cc1nnc(N(C)C)c2nn(-c3ccccc3OC(CCNCCF)c3ccccc3)c(C)c12 |
| InChI | InChI=1S/C26H31FN6O/c1-18-24-19(2)33(31-25(24)26(30-29-18)32(3)4)21-12-8-9-13-23(21)34-22(14-16-28-17-15-27)20-10-6-5-7-11-20/h5-13,22,28H,14-17H2,1-4H3 |
| InChIKey | ZUBLVDGNDOBTSM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|