About 2-(2-methoxyphenyl)-N,N-dimethylpyrazolo[3,4-d]pyridazin-7-amine
2-(2-methoxyphenyl)-N,N-dimethylpyrazolo[3,4-d]pyridazin-7-amine (PubChem CID 134576961) has the molecular formula C14H15N5O
and a molecular weight of 269.31 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-N,N-dimethylpyrazolo[3,4-d]pyridazin-7-amine.
Molecular Properties
| Compound Name | 2-(2-methoxyphenyl)-N,N-dimethylpyrazolo[3,4-d]pyridazin-7-amine |
| PubChem CID | 134576961 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-(2-methoxyphenyl)-N,N-dimethylpyrazolo[3,4-d]pyridazin-7-amine |
| SMILES | COc1ccccc1-n1cc2cnnc(N(C)C)c2n1 |
| InChI | InChI=1S/C14H15N5O/c1-18(2)14-13-10(8-15-16-14)9-19(17-13)11-6-4-5-7-12(11)20-3/h4-9H,1-3H3 |
| InChIKey | MCZVJLPVNVENHG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(2-methoxyphenyl)-N,N-dimethylpyrazolo[3,4-d]pyridazin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxyphenyl)-N,N-dimethylpyrazolo[3,4-d]pyridazin-7-amine?
The IUPAC name of 2-(2-methoxyphenyl)-N,N-dimethylpyrazolo[3,4-d]pyridazin-7-amine (CID 134576961) is 2-(2-methoxyphenyl)-N,N-dimethylpyrazolo[3,4-d]pyridazin-7-amine.
What is the SMILES notation for 2-(2-methoxyphenyl)-N,N-dimethylpyrazolo[3,4-d]pyridazin-7-amine?
The canonical SMILES for 2-(2-methoxyphenyl)-N,N-dimethylpyrazolo[3,4-d]pyridazin-7-amine is COc1ccccc1-n1cc2cnnc(N(C)C)c2n1.
What is the InChIKey of 2-(2-methoxyphenyl)-N,N-dimethylpyrazolo[3,4-d]pyridazin-7-amine?
The InChIKey is MCZVJLPVNVENHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N5O/c1-18(2)14-13-10(8-15-16-14)9-19(17-13)11-6-4-5-7-12(11)20-3/h4-9H,1-3H3.
What are the key properties of 2-(2-methoxyphenyl)-N,N-dimethylpyrazolo[3,4-d]pyridazin-7-amine?
2-(2-methoxyphenyl)-N,N-dimethylpyrazolo[3,4-d]pyridazin-7-amine has a molecular weight of 269.31 g/mol, XLogP of 1.89, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxyphenyl)-N,N-dimethylpyrazolo[3,4-d]pyridazin-7-amine is sourced from PubChem (CID 134576961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).