C18H20OP+ — CID 134577154
(2R,5R)-2,5-bis(4-methylphenyl)phospholan-1-ium 1-oxide (PubChem CID 134577154) has the molecular formula C18H20OP+ and a molecular weight of 283.33 g/mol. Its IUPAC name is (2R,5R)-2,5-bis(4-methylphenyl)phospholan-1-ium 1-oxide.
| Compound Name | (2R,5R)-2,5-bis(4-methylphenyl)phospholan-1-ium 1-oxide |
|---|---|
| PubChem CID | 134577154 |
| Molecular Formula | C18H20OP+ |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (2R,5R)-2,5-bis(4-methylphenyl)phospholan-1-ium 1-oxide |
| SMILES | Cc1ccc([C@H]2CC[C@H](c3ccc(C)cc3)[P+]2=O)cc1 |
| InChI | InChI=1S/C18H20OP/c1-13-3-7-15(8-4-13)17-11-12-18(20(17)19)16-9-5-14(2)6-10-16/h3-10,17-18H,11-12H2,1-2H3/q+1/t17-,18-/m1/s1 |
| InChIKey | XSSIAUORZHWLMW-QZTJIDSGSA-N |
| XLogP | 5.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|