C18H29NO — CID 134577544
(3E,5E)-1-[4,4-dimethyl-1-(2-methylpropyl)-2,3-dihydropyridin-5-yl]hepta-3,5-dien-1-one (PubChem CID 134577544) has the molecular formula C18H29NO and a molecular weight of 275.44 g/mol. Its IUPAC name is (3E,5E)-1-[4,4-dimethyl-1-(2-methylpropyl)-2,3-dihydropyridin-5-yl]hepta-3,5-dien-1-one.
| Compound Name | (3E,5E)-1-[4,4-dimethyl-1-(2-methylpropyl)-2,3-dihydropyridin-5-yl]hepta-3,5-dien-1-one |
|---|---|
| PubChem CID | 134577544 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | (3E,5E)-1-[4,4-dimethyl-1-(2-methylpropyl)-2,3-dihydropyridin-5-yl]hepta-3,5-dien-1-one |
| SMILES | C/C=C/C=C/CC(=O)C1=CN(CC(C)C)CCC1(C)C |
| InChI | InChI=1S/C18H29NO/c1-6-7-8-9-10-17(20)16-14-19(13-15(2)3)12-11-18(16,4)5/h6-9,14-15H,10-13H2,1-5H3/b7-6+,9-8+ |
| InChIKey | CHPOEJKASSIMPD-BLHCBFLLSA-N |
| XLogP | 4.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|