C18H37NO5 — CID 134577589
6-[methyl-[(Z)-undec-9-enyl]amino]hexane-1,2,3,4,5-pentol (PubChem CID 134577589) has the molecular formula C18H37NO5 and a molecular weight of 347.50 g/mol. Its IUPAC name is 6-[methyl-[(Z)-undec-9-enyl]amino]hexane-1,2,3,4,5-pentol.
| Compound Name | 6-[methyl-[(Z)-undec-9-enyl]amino]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 134577589 |
| Molecular Formula | C18H37NO5 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.27 |
| IUPAC Name | 6-[methyl-[(Z)-undec-9-enyl]amino]hexane-1,2,3,4,5-pentol |
| SMILES | C/C=C\CCCCCCCCN(C)CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C18H37NO5/c1-3-4-5-6-7-8-9-10-11-12-19(2)13-15(21)17(23)18(24)16(22)14-20/h3-4,15-18,20-24H,5-14H2,1-2H3/b4-3- |
| InChIKey | VQVKQWLLESXUIB-ARJAWSKDSA-N |
| XLogP | 0.66 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|