C18H35FN8O — CID 134577859
2-amino-6-fluoro-N-[1-methyl-4-(4-methyldiazinan-3-yl)piperidin-3-yl]-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 134577859) has the molecular formula C18H35FN8O and a molecular weight of 398.53 g/mol. Its IUPAC name is 2-amino-6-fluoro-N-[1-methyl-4-(4-methyldiazinan-3-yl)piperidin-3-yl]-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 2-amino-6-fluoro-N-[1-methyl-4-(4-methyldiazinan-3-yl)piperidin-3-yl]-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 134577859 |
| Molecular Formula | C18H35FN8O |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | 2-amino-6-fluoro-N-[1-methyl-4-(4-methyldiazinan-3-yl)piperidin-3-yl]-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CC1CCNNC1C1CCN(C)CC1NC(=O)C1C(N)NN2CC(F)CNC12 |
| InChI | InChI=1S/C18H35FN8O/c1-10-3-5-22-24-15(10)12-4-6-26(2)9-13(12)23-18(28)14-16(20)25-27-8-11(19)7-21-17(14)27/h10-17,21-22,24-25H,3-9,20H2,1-2H3,(H,23,28) |
| InChIKey | AGZZBMWLQLLERL-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 109.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |