C14H15FN6O — CID 134577873
2-amino-6-fluoro-N-[(1E,3Z)-3-methyl-1-(methylideneamino)penta-1,3-dien-2-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 134577873) has the molecular formula C14H15FN6O and a molecular weight of 302.31 g/mol. Its IUPAC name is 2-amino-6-fluoro-N-[(1E,3Z)-3-methyl-1-(methylideneamino)penta-1,3-dien-2-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 2-amino-6-fluoro-N-[(1E,3Z)-3-methyl-1-(methylideneamino)penta-1,3-dien-2-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 134577873 |
| Molecular Formula | C14H15FN6O |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 2-amino-6-fluoro-N-[(1E,3Z)-3-methyl-1-(methylideneamino)penta-1,3-dien-2-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | C=N/C=C(NC(=O)c1c(N)nn2cc(F)cnc12)\C(C)=C/C |
| InChI | InChI=1S/C14H15FN6O/c1-4-8(2)10(6-17-3)19-14(22)11-12(16)20-21-7-9(15)5-18-13(11)21/h4-7H,3H2,1-2H3,(H2,16,20)(H,19,22)/b8-4-,10-6+ |
| InChIKey | WZFWVQVDIBBLAM-KHPAHMTISA-N |
| XLogP | 1.69 |
| TPSA | 97.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|