C16H22O9 — CID 134578071
[(3S,4R,5R)-2,3,5-triacetyloxy-6-prop-1-en-2-yloxan-4-yl] acetate (PubChem CID 134578071) has the molecular formula C16H22O9 and a molecular weight of 358.34 g/mol. Its IUPAC name is [(3S,4R,5R)-2,3,5-triacetyloxy-6-prop-1-en-2-yloxan-4-yl] acetate.
| Compound Name | [(3S,4R,5R)-2,3,5-triacetyloxy-6-prop-1-en-2-yloxan-4-yl] acetate |
|---|---|
| PubChem CID | 134578071 |
| Molecular Formula | C16H22O9 |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | [(3S,4R,5R)-2,3,5-triacetyloxy-6-prop-1-en-2-yloxan-4-yl] acetate |
| SMILES | C=C(C)C1OC(OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H22O9/c1-7(2)12-13(21-8(3)17)14(22-9(4)18)15(23-10(5)19)16(25-12)24-11(6)20/h12-16H,1H2,2-6H3/t12?,13-,14-,15+,16?/m1/s1 |
| InChIKey | KTFUEZXLUSQPQL-PQARUHEFSA-N |
| XLogP | 0.65 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|