C7H10N4 — CID 134578471
2-[(1Z)-buta-1,3-dienyl]-5-methyl-1,2,4-triazol-3-amine (PubChem CID 134578471) has the molecular formula C7H10N4 and a molecular weight of 150.18 g/mol. Its IUPAC name is 2-[(1Z)-buta-1,3-dienyl]-5-methyl-1,2,4-triazol-3-amine.
| Compound Name | 2-[(1Z)-buta-1,3-dienyl]-5-methyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 134578471 |
| Molecular Formula | C7H10N4 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | 2-[(1Z)-buta-1,3-dienyl]-5-methyl-1,2,4-triazol-3-amine |
| SMILES | C=C/C=C\n1nc(C)nc1N |
| InChI | InChI=1S/C7H10N4/c1-3-4-5-11-7(8)9-6(2)10-11/h3-5H,1H2,2H3,(H2,8,9,10)/b5-4- |
| InChIKey | XYOQCKRKDCOLKC-PLNGDYQASA-N |
| XLogP | 0.83 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|