C17H17Cl2N3O2 — CID 134578593
(3S,6S,7S)-6-(3,4-dichlorophenyl)-2,3,7-trimethyl-1,4-dioxo-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-7-carbonitrile (PubChem CID 134578593) has the molecular formula C17H17Cl2N3O2 and a molecular weight of 366.25 g/mol. Its IUPAC name is (3S,6S,7S)-6-(3,4-dichlorophenyl)-2,3,7-trimethyl-1,4-dioxo-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-7-carbonitrile.
| Compound Name | (3S,6S,7S)-6-(3,4-dichlorophenyl)-2,3,7-trimethyl-1,4-dioxo-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-7-carbonitrile |
|---|---|
| PubChem CID | 134578593 |
| Molecular Formula | C17H17Cl2N3O2 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | (3S,6S,7S)-6-(3,4-dichlorophenyl)-2,3,7-trimethyl-1,4-dioxo-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-7-carbonitrile |
| SMILES | C[C@H]1C(=O)N2C(C[C@](C)(C#N)[C@@H]2c2ccc(Cl)c(Cl)c2)C(=O)N1C |
| InChI | InChI=1S/C17H17Cl2N3O2/c1-9-15(23)22-13(16(24)21(9)3)7-17(2,8-20)14(22)10-4-5-11(18)12(19)6-10/h4-6,9,13-14H,7H2,1-3H3/t9-,13?,14-,17+/m0/s1 |
| InChIKey | WYSAHMFLRXSSKM-ONQCUWCUSA-N |
| XLogP | 3.03 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |