C28H29N7O — CID 134578818
7-[3-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 134578818) has the molecular formula C28H29N7O and a molecular weight of 479.59 g/mol. Its IUPAC name is 7-[3-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 7-[3-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 134578818 |
| Molecular Formula | C28H29N7O |
| Molecular Weight | 479.59 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | 7-[3-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | Cc1noc(C)c1-c1cccc(-n2ccc3cnc(Nc4ccc(N5CCN(C)CC5)cc4)nc32)c1 |
| InChI | InChI=1S/C28H29N7O/c1-19-26(20(2)36-32-19)21-5-4-6-25(17-21)35-12-11-22-18-29-28(31-27(22)35)30-23-7-9-24(10-8-23)34-15-13-33(3)14-16-34/h4-12,17-18H,13-16H2,1-3H3,(H,29,30,31) |
| InChIKey | GKPAFOOSMRPPAY-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.59 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|