About N,N-dihydroxy-3,5-dimethyl-1,2-oxazol-4-amine
N,N-dihydroxy-3,5-dimethyl-1,2-oxazol-4-amine (PubChem CID 134578846) has the molecular formula C5H8N2O3
and a molecular weight of 144.13 g/mol. Its IUPAC name is N,N-dihydroxy-3,5-dimethyl-1,2-oxazol-4-amine.
Molecular Properties
| Compound Name | N,N-dihydroxy-3,5-dimethyl-1,2-oxazol-4-amine |
| PubChem CID | 134578846 |
| Molecular Formula | C5H8N2O3 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.05 |
| IUPAC Name | N,N-dihydroxy-3,5-dimethyl-1,2-oxazol-4-amine |
| SMILES | Cc1noc(C)c1N(O)O |
| InChI | InChI=1S/C5H8N2O3/c1-3-5(7(8)9)4(2)10-6-3/h8-9H,1-2H3 |
| InChIKey | NLBFXRQMKWEFRG-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-dihydroxy-3,5-dimethyl-1,2-oxazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dihydroxy-3,5-dimethyl-1,2-oxazol-4-amine?
The IUPAC name of N,N-dihydroxy-3,5-dimethyl-1,2-oxazol-4-amine (CID 134578846) is N,N-dihydroxy-3,5-dimethyl-1,2-oxazol-4-amine.
What is the SMILES notation for N,N-dihydroxy-3,5-dimethyl-1,2-oxazol-4-amine?
The canonical SMILES for N,N-dihydroxy-3,5-dimethyl-1,2-oxazol-4-amine is Cc1noc(C)c1N(O)O.
What is the InChIKey of N,N-dihydroxy-3,5-dimethyl-1,2-oxazol-4-amine?
The InChIKey is NLBFXRQMKWEFRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O3/c1-3-5(7(8)9)4(2)10-6-3/h8-9H,1-2H3.
What are the key properties of N,N-dihydroxy-3,5-dimethyl-1,2-oxazol-4-amine?
N,N-dihydroxy-3,5-dimethyl-1,2-oxazol-4-amine has a molecular weight of 144.13 g/mol, XLogP of 0.88, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dihydroxy-3,5-dimethyl-1,2-oxazol-4-amine is sourced from PubChem (CID 134578846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).