C21H39N5O4S — CID 134578924
2-[2-[6-(1-ethyl-2,5-dioxopyrrolidin-3-yl)sulfanylhexyl-methylamino]ethylcarbamoylamino]-N,2-dimethylpropanamide (PubChem CID 134578924) has the molecular formula C21H39N5O4S and a molecular weight of 457.64 g/mol. Its IUPAC name is 2-[2-[6-(1-ethyl-2,5-dioxopyrrolidin-3-yl)sulfanylhexyl-methylamino]ethylcarbamoylamino]-N,2-dimethylpropanamide.
| Compound Name | 2-[2-[6-(1-ethyl-2,5-dioxopyrrolidin-3-yl)sulfanylhexyl-methylamino]ethylcarbamoylamino]-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 134578924 |
| Molecular Formula | C21H39N5O4S |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | 2-[2-[6-(1-ethyl-2,5-dioxopyrrolidin-3-yl)sulfanylhexyl-methylamino]ethylcarbamoylamino]-N,2-dimethylpropanamide |
| SMILES | CCN1C(=O)CC(SCCCCCCN(C)CCNC(=O)NC(C)(C)C(=O)NC)C1=O |
| InChI | InChI=1S/C21H39N5O4S/c1-6-26-17(27)15-16(18(26)28)31-14-10-8-7-9-12-25(5)13-11-23-20(30)24-21(2,3)19(29)22-4/h16H,6-15H2,1-5H3,(H,22,29)(H2,23,24,30) |
| InChIKey | XLBBCSBMAUOGEL-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|