C45H36N4S — CID 134578997
10-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9,10,10-tetramethylanthracen-2-yl]phenothiazine (PubChem CID 134578997) has the molecular formula C45H36N4S and a molecular weight of 664.88 g/mol. Its IUPAC name is 10-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9,10,10-tetramethylanthracen-2-yl]phenothiazine.
| Compound Name | 10-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9,10,10-tetramethylanthracen-2-yl]phenothiazine |
|---|---|
| PubChem CID | 134578997 |
| Molecular Formula | C45H36N4S |
| Molecular Weight | 664.88 g/mol |
| Exact Mass | 664.27 |
| IUPAC Name | 10-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9,10,10-tetramethylanthracen-2-yl]phenothiazine |
| SMILES | CC1(C)c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2C(C)(C)c2cc(N3c4ccccc4Sc4ccccc43)ccc21 |
| InChI | InChI=1S/C45H36N4S/c1-44(2)33-25-23-31(43-47-41(29-15-7-5-8-16-29)46-42(48-43)30-17-9-6-10-18-30)27-35(33)45(3,4)36-28-32(24-26-34(36)44)49-37-19-11-13-21-39(37)50-40-22-14-12-20-38(40)49/h5-28H,1-4H3 |
| InChIKey | HMVDWIGYQGDJGI-UHFFFAOYSA-N |
| XLogP | 11.77 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.88 |
| LogP ≤ 5 | 11.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |