About (E)-1-(diethylamino)-6,6-dimethylhept-2-en-4-one
(E)-1-(diethylamino)-6,6-dimethylhept-2-en-4-one (PubChem CID 134579114) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is (E)-1-(diethylamino)-6,6-dimethylhept-2-en-4-one.
Molecular Properties
| Compound Name | (E)-1-(diethylamino)-6,6-dimethylhept-2-en-4-one |
| PubChem CID | 134579114 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | (E)-1-(diethylamino)-6,6-dimethylhept-2-en-4-one |
| SMILES | CCN(CC)C/C=C/C(=O)CC(C)(C)C |
| InChI | InChI=1S/C13H25NO/c1-6-14(7-2)10-8-9-12(15)11-13(3,4)5/h8-9H,6-7,10-11H2,1-5H3/b9-8+ |
| InChIKey | NSKBDNXJAGAZEI-CMDGGOBGSA-N |
| XLogP | 2.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(diethylamino)-6,6-dimethylhept-2-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(diethylamino)-6,6-dimethylhept-2-en-4-one?
The IUPAC name of (E)-1-(diethylamino)-6,6-dimethylhept-2-en-4-one (CID 134579114) is (E)-1-(diethylamino)-6,6-dimethylhept-2-en-4-one.
What is the SMILES notation for (E)-1-(diethylamino)-6,6-dimethylhept-2-en-4-one?
The canonical SMILES for (E)-1-(diethylamino)-6,6-dimethylhept-2-en-4-one is CCN(CC)C/C=C/C(=O)CC(C)(C)C.
What is the InChIKey of (E)-1-(diethylamino)-6,6-dimethylhept-2-en-4-one?
The InChIKey is NSKBDNXJAGAZEI-CMDGGOBGSA-N. The full InChI is InChI=1S/C13H25NO/c1-6-14(7-2)10-8-9-12(15)11-13(3,4)5/h8-9H,6-7,10-11H2,1-5H3/b9-8+.
What are the key properties of (E)-1-(diethylamino)-6,6-dimethylhept-2-en-4-one?
(E)-1-(diethylamino)-6,6-dimethylhept-2-en-4-one has a molecular weight of 211.35 g/mol, XLogP of 2.89, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(diethylamino)-6,6-dimethylhept-2-en-4-one is sourced from PubChem (CID 134579114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).