C24H34Cl2N2 — CID 13457914
(7S,11bR)-2-hexyl-7-phenyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline;dihydrochloride (PubChem CID 13457914) has the molecular formula C24H34Cl2N2 and a molecular weight of 421.46 g/mol. Its IUPAC name is (7S,11bR)-2-hexyl-7-phenyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline;dihydrochloride.
| Compound Name | (7S,11bR)-2-hexyl-7-phenyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline;dihydrochloride |
|---|---|
| PubChem CID | 13457914 |
| Molecular Formula | C24H34Cl2N2 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | (7S,11bR)-2-hexyl-7-phenyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline;dihydrochloride |
| SMILES | CCCCCCN1CCN2C[C@@H](c3ccccc3)c3ccccc3[C@@H]2C1.Cl.Cl |
| InChI | InChI=1S/C24H32N2.2ClH/c1-2-3-4-10-15-25-16-17-26-18-23(20-11-6-5-7-12-20)21-13-8-9-14-22(21)24(26)19-25;;/h5-9,11-14,23-24H,2-4,10,15-19H2,1H3;2*1H/t23-,24-;;/m0../s1 |
| InChIKey | YQDYIICZOKGPAI-WLKYSPGFSA-N |
| XLogP | 5.91 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|