C48H45N3O5 — CID 134579796
3-[6-[3-[5-[4-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]pentyl]-1H-indol-5-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 134579796) has the molecular formula C48H45N3O5 and a molecular weight of 743.90 g/mol. Its IUPAC name is 3-[6-[3-[5-[4-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]pentyl]-1H-indol-5-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[3-[5-[4-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]pentyl]-1H-indol-5-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 134579796 |
| Molecular Formula | C48H45N3O5 |
| Molecular Weight | 743.90 g/mol |
| Exact Mass | 743.34 |
| IUPAC Name | 3-[6-[3-[5-[4-[(1R,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]pentyl]-1H-indol-5-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(-c4ccc5[nH]cc(CCCCCOc6ccc([C@@H]7c8ccc(O)cc8CC[C@@H]7c7ccccc7)cc6)c5c4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C48H45N3O5/c52-37-15-20-40-34(26-37)13-18-39(30-7-3-1-4-8-30)46(40)31-10-16-38(17-11-31)56-24-6-2-5-9-35-28-49-43-21-14-33(27-42(35)43)32-12-19-41-36(25-32)29-51(48(41)55)44-22-23-45(53)50-47(44)54/h1,3-4,7-8,10-12,14-17,19-21,25-28,39,44,46,49,52H,2,5-6,9,13,18,22-24,29H2,(H,50,53,54)/t39-,44?,46+/m1/s1 |
| InChIKey | XQHADOAQRHDTDY-FRKWRHFDSA-N |
| XLogP | 8.96 |
| TPSA | 111.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.90 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|