C44H45FO6S — CID 134580065
2-[4-[4-[2-(4-fluorophenyl)-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]cyclohexyl]oxyethyl 4-methylbenzenesulfonate (PubChem CID 134580065) has the molecular formula C44H45FO6S and a molecular weight of 720.90 g/mol. Its IUPAC name is 2-[4-[4-[2-(4-fluorophenyl)-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]cyclohexyl]oxyethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[4-[4-[2-(4-fluorophenyl)-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]cyclohexyl]oxyethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134580065 |
| Molecular Formula | C44H45FO6S |
| Molecular Weight | 720.90 g/mol |
| Exact Mass | 720.29 |
| IUPAC Name | 2-[4-[4-[2-(4-fluorophenyl)-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]cyclohexyl]oxyethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOC2CCC(Oc3ccc(C4c5ccc(OCc6ccccc6)cc5CCC4c4ccc(F)cc4)cc3)CC2)cc1 |
| InChI | InChI=1S/C44H45FO6S/c1-31-7-23-41(24-8-31)52(46,47)50-28-27-48-37-18-20-39(21-19-37)51-38-16-11-34(12-17-38)44-42(33-9-14-36(45)15-10-33)25-13-35-29-40(22-26-43(35)44)49-30-32-5-3-2-4-6-32/h2-12,14-17,22-24,26,29,37,39,42,44H,13,18-21,25,27-28,30H2,1H3 |
| InChIKey | VIVNNADGVUULBF-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.90 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|