About 4-(2,5-dimethyl-5-piperazin-1-ylhexan-2-yl)-3-methylmorpholine
4-(2,5-dimethyl-5-piperazin-1-ylhexan-2-yl)-3-methylmorpholine (PubChem CID 134580085) has the molecular formula C17H35N3O
and a molecular weight of 297.49 g/mol. Its IUPAC name is 4-(2,5-dimethyl-5-piperazin-1-ylhexan-2-yl)-3-methylmorpholine.
Molecular Properties
| Compound Name | 4-(2,5-dimethyl-5-piperazin-1-ylhexan-2-yl)-3-methylmorpholine |
| PubChem CID | 134580085 |
| Molecular Formula | C17H35N3O |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.28 |
| IUPAC Name | 4-(2,5-dimethyl-5-piperazin-1-ylhexan-2-yl)-3-methylmorpholine |
| SMILES | CC1COCCN1C(C)(C)CCC(C)(C)N1CCNCC1 |
| InChI | InChI=1S/C17H35N3O/c1-15-14-21-13-12-20(15)17(4,5)7-6-16(2,3)19-10-8-18-9-11-19/h15,18H,6-14H2,1-5H3 |
| InChIKey | VXFGSNFZDNCZIR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2,5-dimethyl-5-piperazin-1-ylhexan-2-yl)-3-methylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-dimethyl-5-piperazin-1-ylhexan-2-yl)-3-methylmorpholine?
The IUPAC name of 4-(2,5-dimethyl-5-piperazin-1-ylhexan-2-yl)-3-methylmorpholine (CID 134580085) is 4-(2,5-dimethyl-5-piperazin-1-ylhexan-2-yl)-3-methylmorpholine.
What is the SMILES notation for 4-(2,5-dimethyl-5-piperazin-1-ylhexan-2-yl)-3-methylmorpholine?
The canonical SMILES for 4-(2,5-dimethyl-5-piperazin-1-ylhexan-2-yl)-3-methylmorpholine is CC1COCCN1C(C)(C)CCC(C)(C)N1CCNCC1.
What is the InChIKey of 4-(2,5-dimethyl-5-piperazin-1-ylhexan-2-yl)-3-methylmorpholine?
The InChIKey is VXFGSNFZDNCZIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35N3O/c1-15-14-21-13-12-20(15)17(4,5)7-6-16(2,3)19-10-8-18-9-11-19/h15,18H,6-14H2,1-5H3.
What are the key properties of 4-(2,5-dimethyl-5-piperazin-1-ylhexan-2-yl)-3-methylmorpholine?
4-(2,5-dimethyl-5-piperazin-1-ylhexan-2-yl)-3-methylmorpholine has a molecular weight of 297.49 g/mol, XLogP of 1.95, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dimethyl-5-piperazin-1-ylhexan-2-yl)-3-methylmorpholine is sourced from PubChem (CID 134580085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).