C28H28FNO2 — CID 134580086
1-[3-fluoro-4-[(1S,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidine-4-carbaldehyde (PubChem CID 134580086) has the molecular formula C28H28FNO2 and a molecular weight of 429.54 g/mol. Its IUPAC name is 1-[3-fluoro-4-[(1S,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidine-4-carbaldehyde.
| Compound Name | 1-[3-fluoro-4-[(1S,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 134580086 |
| Molecular Formula | C28H28FNO2 |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 1-[3-fluoro-4-[(1S,2S)-6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]piperidine-4-carbaldehyde |
| SMILES | O=CC1CCN(c2ccc([C@@H]3c4ccc(O)cc4CC[C@@H]3c3ccccc3)c(F)c2)CC1 |
| InChI | InChI=1S/C28H28FNO2/c29-27-17-22(30-14-12-19(18-31)13-15-30)7-10-26(27)28-24(20-4-2-1-3-5-20)9-6-21-16-23(32)8-11-25(21)28/h1-5,7-8,10-11,16-19,24,28,32H,6,9,12-15H2/t24-,28+/m1/s1 |
| InChIKey | VKLHWTAODJTJEX-YWEHKCAJSA-N |
| XLogP | 5.81 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|