C12H16O3 — CID 134580097
spiro[1,3-dioxolane-2,7'-3,4,4a,5,6,8-hexahydronaphthalene]-2'-one (PubChem CID 134580097) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is spiro[1,3-dioxolane-2,7'-3,4,4a,5,6,8-hexahydronaphthalene]-2'-one.
| Compound Name | spiro[1,3-dioxolane-2,7'-3,4,4a,5,6,8-hexahydronaphthalene]-2'-one |
|---|---|
| PubChem CID | 134580097 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | spiro[1,3-dioxolane-2,7'-3,4,4a,5,6,8-hexahydronaphthalene]-2'-one |
| SMILES | O=C1C=C2CC3(CCC2CC1)OCCO3 |
| InChI | InChI=1S/C12H16O3/c13-11-2-1-9-3-4-12(8-10(9)7-11)14-5-6-15-12/h7,9H,1-6,8H2 |
| InChIKey | CXEDZCOXLSCZOL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |