C30H34FNO3 — CID 134580124
(5R,6S)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]-3-fluorophenyl]-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 134580124) has the molecular formula C30H34FNO3 and a molecular weight of 475.60 g/mol. Its IUPAC name is (5R,6S)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]-3-fluorophenyl]-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | (5R,6S)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]-3-fluorophenyl]-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 134580124 |
| Molecular Formula | C30H34FNO3 |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | (5R,6S)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]-3-fluorophenyl]-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | COC(OC)C1CCN(c2ccc([C@@H]3c4ccc(O)cc4CC[C@@H]3c3ccccc3)cc2F)CC1 |
| InChI | InChI=1S/C30H34FNO3/c1-34-30(35-2)21-14-16-32(17-15-21)28-13-9-23(19-27(28)31)29-25(20-6-4-3-5-7-20)11-8-22-18-24(33)10-12-26(22)29/h3-7,9-10,12-13,18-19,21,25,29-30,33H,8,11,14-17H2,1-2H3/t25-,29+/m1/s1 |
| InChIKey | NAKGORBREIHOGA-IRPSRAIASA-N |
| XLogP | 6.23 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|