About tert-butyl 4-[1-(2,6-dioxopiperidin-3-yl)-6-oxopyrimidin-4-yl]piperazine-1-carboxylate
tert-butyl 4-[1-(2,6-dioxopiperidin-3-yl)-6-oxopyrimidin-4-yl]piperazine-1-carboxylate (PubChem CID 134580134) has the molecular formula C18H25N5O5
and a molecular weight of 391.43 g/mol. Its IUPAC name is tert-butyl 4-[1-(2,6-dioxopiperidin-3-yl)-6-oxopyrimidin-4-yl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[1-(2,6-dioxopiperidin-3-yl)-6-oxopyrimidin-4-yl]piperazine-1-carboxylate |
| PubChem CID | 134580134 |
| Molecular Formula | C18H25N5O5 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | tert-butyl 4-[1-(2,6-dioxopiperidin-3-yl)-6-oxopyrimidin-4-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cc(=O)n(C3CCC(=O)NC3=O)cn2)CC1 |
| InChI | InChI=1S/C18H25N5O5/c1-18(2,3)28-17(27)22-8-6-21(7-9-22)13-10-15(25)23(11-19-13)12-4-5-14(24)20-16(12)26/h10-12H,4-9H2,1-3H3,(H,20,24,26) |
| InChIKey | UPYUNZQGIRLKRJ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 113.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-[1-(2,6-dioxopiperidin-3-yl)-6-oxopyrimidin-4-yl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[1-(2,6-dioxopiperidin-3-yl)-6-oxopyrimidin-4-yl]piperazine-1-carboxylate?
The IUPAC name of tert-butyl 4-[1-(2,6-dioxopiperidin-3-yl)-6-oxopyrimidin-4-yl]piperazine-1-carboxylate (CID 134580134) is tert-butyl 4-[1-(2,6-dioxopiperidin-3-yl)-6-oxopyrimidin-4-yl]piperazine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[1-(2,6-dioxopiperidin-3-yl)-6-oxopyrimidin-4-yl]piperazine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[1-(2,6-dioxopiperidin-3-yl)-6-oxopyrimidin-4-yl]piperazine-1-carboxylate is CC(C)(C)OC(=O)N1CCN(c2cc(=O)n(C3CCC(=O)NC3=O)cn2)CC1.
What is the InChIKey of tert-butyl 4-[1-(2,6-dioxopiperidin-3-yl)-6-oxopyrimidin-4-yl]piperazine-1-carboxylate?
The InChIKey is UPYUNZQGIRLKRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N5O5/c1-18(2,3)28-17(27)22-8-6-21(7-9-22)13-10-15(25)23(11-19-13)12-4-5-14(24)20-16(12)26/h10-12H,4-9H2,1-3H3,(H,20,24,26).
What are the key properties of tert-butyl 4-[1-(2,6-dioxopiperidin-3-yl)-6-oxopyrimidin-4-yl]piperazine-1-carboxylate?
tert-butyl 4-[1-(2,6-dioxopiperidin-3-yl)-6-oxopyrimidin-4-yl]piperazine-1-carboxylate has a molecular weight of 391.43 g/mol, XLogP of 0.28, 2 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[1-(2,6-dioxopiperidin-3-yl)-6-oxopyrimidin-4-yl]piperazine-1-carboxylate is sourced from PubChem (CID 134580134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).