C21H20N6O5 — CID 134580231
2-(2,6-dioxopiperidin-3-yl)-5-(2-piperazin-1-ylpyrimidin-5-yl)oxyisoindole-1,3-dione (PubChem CID 134580231) has the molecular formula C21H20N6O5 and a molecular weight of 436.43 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-(2-piperazin-1-ylpyrimidin-5-yl)oxyisoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-(2-piperazin-1-ylpyrimidin-5-yl)oxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 134580231 |
| Molecular Formula | C21H20N6O5 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-(2-piperazin-1-ylpyrimidin-5-yl)oxyisoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(Oc4cnc(N5CCNCC5)nc4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H20N6O5/c28-17-4-3-16(18(29)25-17)27-19(30)14-2-1-12(9-15(14)20(27)31)32-13-10-23-21(24-11-13)26-7-5-22-6-8-26/h1-2,9-11,16,22H,3-8H2,(H,25,28,29) |
| InChIKey | SCRSXWASDWOZFJ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|