C31H27O2P — CID 134580548
(3S)-3-methyl-4-[10-(2,4,6-trimethylphenyl)anthracen-9-yl]-2H-1,3λ5-benzoxaphosphole 3-oxide (PubChem CID 134580548) has the molecular formula C31H27O2P and a molecular weight of 462.53 g/mol. Its IUPAC name is (3S)-3-methyl-4-[10-(2,4,6-trimethylphenyl)anthracen-9-yl]-2H-1,3λ5-benzoxaphosphole 3-oxide.
| Compound Name | (3S)-3-methyl-4-[10-(2,4,6-trimethylphenyl)anthracen-9-yl]-2H-1,3λ5-benzoxaphosphole 3-oxide |
|---|---|
| PubChem CID | 134580548 |
| Molecular Formula | C31H27O2P |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | (3S)-3-methyl-4-[10-(2,4,6-trimethylphenyl)anthracen-9-yl]-2H-1,3λ5-benzoxaphosphole 3-oxide |
| SMILES | Cc1cc(C)c(-c2c3ccccc3c(-c3cccc4c3[P@](C)(=O)CO4)c3ccccc23)c(C)c1 |
| InChI | InChI=1S/C31H27O2P/c1-19-16-20(2)28(21(3)17-19)30-24-12-7-5-10-22(24)29(23-11-6-8-13-25(23)30)26-14-9-15-27-31(26)34(4,32)18-33-27/h5-17H,18H2,1-4H3/t34-/m1/s1 |
| InChIKey | MWJUGPXPWFNDPU-UUWRZZSWSA-N |
| XLogP | 8.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|