About 2-(5-bromospiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-yl)-N,N-dimethylethanamine
2-(5-bromospiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-yl)-N,N-dimethylethanamine (PubChem CID 13458056) has the molecular formula C17H24BrNO
and a molecular weight of 338.29 g/mol. Its IUPAC name is 2-(5-bromospiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-yl)-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-(5-bromospiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-yl)-N,N-dimethylethanamine |
| PubChem CID | 13458056 |
| Molecular Formula | C17H24BrNO |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 2-(5-bromospiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-yl)-N,N-dimethylethanamine |
| SMILES | CN(C)CCC1CCCCC12Cc1cc(Br)ccc1O2 |
| InChI | InChI=1S/C17H24BrNO/c1-19(2)10-8-14-5-3-4-9-17(14)12-13-11-15(18)6-7-16(13)20-17/h6-7,11,14H,3-5,8-10,12H2,1-2H3 |
| InChIKey | GHXZKZVMOWKHPM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(5-bromospiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-yl)-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-bromospiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-yl)-N,N-dimethylethanamine?
The IUPAC name of 2-(5-bromospiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-yl)-N,N-dimethylethanamine (CID 13458056) is 2-(5-bromospiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-yl)-N,N-dimethylethanamine.
What is the SMILES notation for 2-(5-bromospiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-yl)-N,N-dimethylethanamine?
The canonical SMILES for 2-(5-bromospiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-yl)-N,N-dimethylethanamine is CN(C)CCC1CCCCC12Cc1cc(Br)ccc1O2.
What is the InChIKey of 2-(5-bromospiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-yl)-N,N-dimethylethanamine?
The InChIKey is GHXZKZVMOWKHPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24BrNO/c1-19(2)10-8-14-5-3-4-9-17(14)12-13-11-15(18)6-7-16(13)20-17/h6-7,11,14H,3-5,8-10,12H2,1-2H3.
What are the key properties of 2-(5-bromospiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-yl)-N,N-dimethylethanamine?
2-(5-bromospiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-yl)-N,N-dimethylethanamine has a molecular weight of 338.29 g/mol, XLogP of 4.26, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-bromospiro[3H-1-benzofuran-2,2'-cyclohexane]-1'-yl)-N,N-dimethylethanamine is sourced from PubChem (CID 13458056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).