C12H19N5OS2 — CID 13458067
3-N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1,2,5-thiadiazole-3,4-diamine (PubChem CID 13458067) has the molecular formula C12H19N5OS2 and a molecular weight of 313.45 g/mol. Its IUPAC name is 3-N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1,2,5-thiadiazole-3,4-diamine.
| Compound Name | 3-N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1,2,5-thiadiazole-3,4-diamine |
|---|---|
| PubChem CID | 13458067 |
| Molecular Formula | C12H19N5OS2 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 3-N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1,2,5-thiadiazole-3,4-diamine |
| SMILES | CN(C)Cc1ccc(CSCCNc2nsnc2N)o1 |
| InChI | InChI=1S/C12H19N5OS2/c1-17(2)7-9-3-4-10(18-9)8-19-6-5-14-12-11(13)15-20-16-12/h3-4H,5-8H2,1-2H3,(H2,13,15)(H,14,16) |
| InChIKey | XLMCTHGDIZFBND-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 80.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|