C22H18F9N3O2 — CID 134581279
N'-[[4-[5-[3,5-bis(trifluoromethyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylphenyl]methyl]-N-methoxymethanimidamide (PubChem CID 134581279) has the molecular formula C22H18F9N3O2 and a molecular weight of 527.39 g/mol. Its IUPAC name is N'-[[4-[5-[3,5-bis(trifluoromethyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylphenyl]methyl]-N-methoxymethanimidamide.
| Compound Name | N'-[[4-[5-[3,5-bis(trifluoromethyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylphenyl]methyl]-N-methoxymethanimidamide |
|---|---|
| PubChem CID | 134581279 |
| Molecular Formula | C22H18F9N3O2 |
| Molecular Weight | 527.39 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | N'-[[4-[5-[3,5-bis(trifluoromethyl)phenyl]-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylphenyl]methyl]-N-methoxymethanimidamide |
| SMILES | CON/C=N/Cc1ccc(C2=NOC(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)(C(F)(F)F)C2)cc1C |
| InChI | InChI=1S/C22H18F9N3O2/c1-12-5-13(3-4-14(12)10-32-11-33-35-2)18-9-19(36-34-18,22(29,30)31)15-6-16(20(23,24)25)8-17(7-15)21(26,27)28/h3-8,11H,9-10H2,1-2H3,(H,32,33) |
| InChIKey | KSCLQOFXSZXIAW-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.39 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|