C19H16FN3O3S — CID 134581398
N'-(benzenesulfonyl)-2-fluoro-3-methyl-5-pyridin-2-ylbenzohydrazide (PubChem CID 134581398) has the molecular formula C19H16FN3O3S and a molecular weight of 385.42 g/mol. Its IUPAC name is N'-(benzenesulfonyl)-2-fluoro-3-methyl-5-pyridin-2-ylbenzohydrazide.
| Compound Name | N'-(benzenesulfonyl)-2-fluoro-3-methyl-5-pyridin-2-ylbenzohydrazide |
|---|---|
| PubChem CID | 134581398 |
| Molecular Formula | C19H16FN3O3S |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | N'-(benzenesulfonyl)-2-fluoro-3-methyl-5-pyridin-2-ylbenzohydrazide |
| SMILES | Cc1cc(-c2ccccn2)cc(C(=O)NNS(=O)(=O)c2ccccc2)c1F |
| InChI | InChI=1S/C19H16FN3O3S/c1-13-11-14(17-9-5-6-10-21-17)12-16(18(13)20)19(24)22-23-27(25,26)15-7-3-2-4-8-15/h2-12,23H,1H3,(H,22,24) |
| InChIKey | MWANLGMUCLJUNG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|