About 1-methyl-1-[(3Z)-6-methylhepta-1,3-dien-4-yl]hydrazine
1-methyl-1-[(3Z)-6-methylhepta-1,3-dien-4-yl]hydrazine (PubChem CID 134581483) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is 1-methyl-1-[(3Z)-6-methylhepta-1,3-dien-4-yl]hydrazine.
Molecular Properties
| Compound Name | 1-methyl-1-[(3Z)-6-methylhepta-1,3-dien-4-yl]hydrazine |
| PubChem CID | 134581483 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 1-methyl-1-[(3Z)-6-methylhepta-1,3-dien-4-yl]hydrazine |
| SMILES | C=C/C=C(/CC(C)C)N(C)N |
| InChI | InChI=1S/C9H18N2/c1-5-6-9(11(4)10)7-8(2)3/h5-6,8H,1,7,10H2,2-4H3/b9-6- |
| InChIKey | DBCCOJAIPDNLAK-TWGQIWQCSA-N |
| XLogP | 1.91 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-1-[(3Z)-6-methylhepta-1,3-dien-4-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-1-[(3Z)-6-methylhepta-1,3-dien-4-yl]hydrazine?
The IUPAC name of 1-methyl-1-[(3Z)-6-methylhepta-1,3-dien-4-yl]hydrazine (CID 134581483) is 1-methyl-1-[(3Z)-6-methylhepta-1,3-dien-4-yl]hydrazine.
What is the SMILES notation for 1-methyl-1-[(3Z)-6-methylhepta-1,3-dien-4-yl]hydrazine?
The canonical SMILES for 1-methyl-1-[(3Z)-6-methylhepta-1,3-dien-4-yl]hydrazine is C=C/C=C(/CC(C)C)N(C)N.
What is the InChIKey of 1-methyl-1-[(3Z)-6-methylhepta-1,3-dien-4-yl]hydrazine?
The InChIKey is DBCCOJAIPDNLAK-TWGQIWQCSA-N. The full InChI is InChI=1S/C9H18N2/c1-5-6-9(11(4)10)7-8(2)3/h5-6,8H,1,7,10H2,2-4H3/b9-6-.
What are the key properties of 1-methyl-1-[(3Z)-6-methylhepta-1,3-dien-4-yl]hydrazine?
1-methyl-1-[(3Z)-6-methylhepta-1,3-dien-4-yl]hydrazine has a molecular weight of 154.26 g/mol, XLogP of 1.91, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-1-[(3Z)-6-methylhepta-1,3-dien-4-yl]hydrazine is sourced from PubChem (CID 134581483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).