C24H32N2 — CID 134581642
(3E,5E,7Z)-6-[C-ethyl-N-[5-methyl-7-(2-methylprop-1-enyl)cyclohepta-1,3,6-trien-1-yl]carbonimidoyl]nona-1,3,5,7-tetraen-3-amine (PubChem CID 134581642) has the molecular formula C24H32N2 and a molecular weight of 348.53 g/mol. Its IUPAC name is (3E,5E,7Z)-6-[C-ethyl-N-[5-methyl-7-(2-methylprop-1-enyl)cyclohepta-1,3,6-trien-1-yl]carbonimidoyl]nona-1,3,5,7-tetraen-3-amine.
| Compound Name | (3E,5E,7Z)-6-[C-ethyl-N-[5-methyl-7-(2-methylprop-1-enyl)cyclohepta-1,3,6-trien-1-yl]carbonimidoyl]nona-1,3,5,7-tetraen-3-amine |
|---|---|
| PubChem CID | 134581642 |
| Molecular Formula | C24H32N2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | (3E,5E,7Z)-6-[C-ethyl-N-[5-methyl-7-(2-methylprop-1-enyl)cyclohepta-1,3,6-trien-1-yl]carbonimidoyl]nona-1,3,5,7-tetraen-3-amine |
| SMILES | C=C/C(N)=C\C=C(/C=C\C)C(\CC)=N\C1=CC=CC(C)C=C1C=C(C)C |
| InChI | InChI=1S/C24H32N2/c1-7-11-20(14-15-22(25)8-2)23(9-3)26-24-13-10-12-19(6)17-21(24)16-18(4)5/h7-8,10-17,19H,2,9,25H2,1,3-6H3/b11-7-,20-14+,22-15+,26-23+ |
| InChIKey | ZAEOVWGGYQMZIO-ZTLCXTJJSA-N |
| XLogP | 6.35 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|