C21H28N2O3S — CID 13458179
ethyl 4-(4-tert-butylphenoxy)-2-(2-methylpropylsulfanyl)pyrimidine-5-carboxylate (PubChem CID 13458179) has the molecular formula C21H28N2O3S and a molecular weight of 388.53 g/mol. Its IUPAC name is ethyl 4-(4-tert-butylphenoxy)-2-(2-methylpropylsulfanyl)pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(4-tert-butylphenoxy)-2-(2-methylpropylsulfanyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 13458179 |
| Molecular Formula | C21H28N2O3S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | ethyl 4-(4-tert-butylphenoxy)-2-(2-methylpropylsulfanyl)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SCC(C)C)nc1Oc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H28N2O3S/c1-7-25-19(24)17-12-22-20(27-13-14(2)3)23-18(17)26-16-10-8-15(9-11-16)21(4,5)6/h8-12,14H,7,13H2,1-6H3 |
| InChIKey | FEPFOCXQYVRWBO-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |