About [2,4-dimethyl-5-[5-(3-propan-2-yloxycyclobutyl)oxypyrimidin-2-yl]pentyl] hypoiodite
[2,4-dimethyl-5-[5-(3-propan-2-yloxycyclobutyl)oxypyrimidin-2-yl]pentyl] hypoiodite (PubChem CID 134581891) has the molecular formula C18H29IN2O3
and a molecular weight of 448.35 g/mol. Its IUPAC name is [2,4-dimethyl-5-[5-(3-propan-2-yloxycyclobutyl)oxypyrimidin-2-yl]pentyl] hypoiodite.
Molecular Properties
| Compound Name | [2,4-dimethyl-5-[5-(3-propan-2-yloxycyclobutyl)oxypyrimidin-2-yl]pentyl] hypoiodite |
| PubChem CID | 134581891 |
| Molecular Formula | C18H29IN2O3 |
| Molecular Weight | 448.35 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | [2,4-dimethyl-5-[5-(3-propan-2-yloxycyclobutyl)oxypyrimidin-2-yl]pentyl] hypoiodite |
| SMILES | CC(COI)CC(C)Cc1ncc(OC2CC(OC(C)C)C2)cn1 |
| InChI | InChI=1S/C18H29IN2O3/c1-12(2)23-15-7-16(8-15)24-17-9-20-18(21-10-17)6-13(3)5-14(4)11-22-19/h9-10,12-16H,5-8,11H2,1-4H3 |
| InChIKey | ULDVSXFJMZDFIV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.35 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [2,4-dimethyl-5-[5-(3-propan-2-yloxycyclobutyl)oxypyrimidin-2-yl]pentyl] hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,4-dimethyl-5-[5-(3-propan-2-yloxycyclobutyl)oxypyrimidin-2-yl]pentyl] hypoiodite?
The IUPAC name of [2,4-dimethyl-5-[5-(3-propan-2-yloxycyclobutyl)oxypyrimidin-2-yl]pentyl] hypoiodite (CID 134581891) is [2,4-dimethyl-5-[5-(3-propan-2-yloxycyclobutyl)oxypyrimidin-2-yl]pentyl] hypoiodite.
What is the SMILES notation for [2,4-dimethyl-5-[5-(3-propan-2-yloxycyclobutyl)oxypyrimidin-2-yl]pentyl] hypoiodite?
The canonical SMILES for [2,4-dimethyl-5-[5-(3-propan-2-yloxycyclobutyl)oxypyrimidin-2-yl]pentyl] hypoiodite is CC(COI)CC(C)Cc1ncc(OC2CC(OC(C)C)C2)cn1.
What is the InChIKey of [2,4-dimethyl-5-[5-(3-propan-2-yloxycyclobutyl)oxypyrimidin-2-yl]pentyl] hypoiodite?
The InChIKey is ULDVSXFJMZDFIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29IN2O3/c1-12(2)23-15-7-16(8-15)24-17-9-20-18(21-10-17)6-13(3)5-14(4)11-22-19/h9-10,12-16H,5-8,11H2,1-4H3.
What are the key properties of [2,4-dimethyl-5-[5-(3-propan-2-yloxycyclobutyl)oxypyrimidin-2-yl]pentyl] hypoiodite?
[2,4-dimethyl-5-[5-(3-propan-2-yloxycyclobutyl)oxypyrimidin-2-yl]pentyl] hypoiodite has a molecular weight of 448.35 g/mol, XLogP of 4.38, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2,4-dimethyl-5-[5-(3-propan-2-yloxycyclobutyl)oxypyrimidin-2-yl]pentyl] hypoiodite is sourced from PubChem (CID 134581891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).