C27H19N3 — CID 134581962
2-phenyl-4-[4-(3-phenylphenyl)phenyl]-1,3,5-triazine (PubChem CID 134581962) has the molecular formula C27H19N3 and a molecular weight of 385.47 g/mol. Its IUPAC name is 2-phenyl-4-[4-(3-phenylphenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2-phenyl-4-[4-(3-phenylphenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 134581962 |
| Molecular Formula | C27H19N3 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 2-phenyl-4-[4-(3-phenylphenyl)phenyl]-1,3,5-triazine |
| SMILES | c1ccc(-c2cccc(-c3ccc(-c4ncnc(-c5ccccc5)n4)cc3)c2)cc1 |
| InChI | InChI=1S/C27H19N3/c1-3-8-20(9-4-1)24-12-7-13-25(18-24)21-14-16-23(17-15-21)27-29-19-28-26(30-27)22-10-5-2-6-11-22/h1-19H |
| InChIKey | UCOYVJKXLIIXBN-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |