C10H19NO5 — CID 134582219
N-[2-[(3S)-3,4,5-trihydroxy-2-methyloxan-3-yl]ethyl]acetamide (PubChem CID 134582219) has the molecular formula C10H19NO5 and a molecular weight of 233.26 g/mol. Its IUPAC name is N-[2-[(3S)-3,4,5-trihydroxy-2-methyloxan-3-yl]ethyl]acetamide.
| Compound Name | N-[2-[(3S)-3,4,5-trihydroxy-2-methyloxan-3-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 134582219 |
| Molecular Formula | C10H19NO5 |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | N-[2-[(3S)-3,4,5-trihydroxy-2-methyloxan-3-yl]ethyl]acetamide |
| SMILES | CC(=O)NCC[C@@]1(O)C(C)OCC(O)C1O |
| InChI | InChI=1S/C10H19NO5/c1-6-10(15,3-4-11-7(2)12)9(14)8(13)5-16-6/h6,8-9,13-15H,3-5H2,1-2H3,(H,11,12)/t6?,8?,9?,10-/m1/s1 |
| InChIKey | SJZJKPDHPUCXCD-NEEVAGLGSA-N |
| XLogP | -1.62 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |