About (2R)-4-ethoxy-2-(trifluoromethyl)pentane-1,2,3-triol
(2R)-4-ethoxy-2-(trifluoromethyl)pentane-1,2,3-triol (PubChem CID 134582397) has the molecular formula C8H15F3O4
and a molecular weight of 232.20 g/mol. Its IUPAC name is (2R)-4-ethoxy-2-(trifluoromethyl)pentane-1,2,3-triol.
Molecular Properties
| Compound Name | (2R)-4-ethoxy-2-(trifluoromethyl)pentane-1,2,3-triol |
| PubChem CID | 134582397 |
| Molecular Formula | C8H15F3O4 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | (2R)-4-ethoxy-2-(trifluoromethyl)pentane-1,2,3-triol |
| SMILES | CCOC(C)C(O)[C@](O)(CO)C(F)(F)F |
| InChI | InChI=1S/C8H15F3O4/c1-3-15-5(2)6(13)7(14,4-12)8(9,10)11/h5-6,12-14H,3-4H2,1-2H3/t5?,6?,7-/m1/s1 |
| InChIKey | ANFHIICBBGYIDK-KPGICGJXSA-N |
| XLogP | 0.06 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-4-ethoxy-2-(trifluoromethyl)pentane-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4-ethoxy-2-(trifluoromethyl)pentane-1,2,3-triol?
The IUPAC name of (2R)-4-ethoxy-2-(trifluoromethyl)pentane-1,2,3-triol (CID 134582397) is (2R)-4-ethoxy-2-(trifluoromethyl)pentane-1,2,3-triol.
What is the SMILES notation for (2R)-4-ethoxy-2-(trifluoromethyl)pentane-1,2,3-triol?
The canonical SMILES for (2R)-4-ethoxy-2-(trifluoromethyl)pentane-1,2,3-triol is CCOC(C)C(O)[C@](O)(CO)C(F)(F)F.
What is the InChIKey of (2R)-4-ethoxy-2-(trifluoromethyl)pentane-1,2,3-triol?
The InChIKey is ANFHIICBBGYIDK-KPGICGJXSA-N. The full InChI is InChI=1S/C8H15F3O4/c1-3-15-5(2)6(13)7(14,4-12)8(9,10)11/h5-6,12-14H,3-4H2,1-2H3/t5?,6?,7-/m1/s1.
What are the key properties of (2R)-4-ethoxy-2-(trifluoromethyl)pentane-1,2,3-triol?
(2R)-4-ethoxy-2-(trifluoromethyl)pentane-1,2,3-triol has a molecular weight of 232.20 g/mol, XLogP of 0.06, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4-ethoxy-2-(trifluoromethyl)pentane-1,2,3-triol is sourced from PubChem (CID 134582397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).