About benzyl 2-methyl-3-[(2S,4S)-4-(2-methylpropoxy)-1-propan-2-ylpyrrolidin-2-yl]-3-oxopropanoate
benzyl 2-methyl-3-[(2S,4S)-4-(2-methylpropoxy)-1-propan-2-ylpyrrolidin-2-yl]-3-oxopropanoate (PubChem CID 134582597) has the molecular formula C22H33NO4
and a molecular weight of 375.51 g/mol. Its IUPAC name is benzyl 2-methyl-3-[(2S,4S)-4-(2-methylpropoxy)-1-propan-2-ylpyrrolidin-2-yl]-3-oxopropanoate.
Molecular Properties
| Compound Name | benzyl 2-methyl-3-[(2S,4S)-4-(2-methylpropoxy)-1-propan-2-ylpyrrolidin-2-yl]-3-oxopropanoate |
| PubChem CID | 134582597 |
| Molecular Formula | C22H33NO4 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | benzyl 2-methyl-3-[(2S,4S)-4-(2-methylpropoxy)-1-propan-2-ylpyrrolidin-2-yl]-3-oxopropanoate |
| SMILES | CC(C)CO[C@H]1C[C@@H](C(=O)C(C)C(=O)OCc2ccccc2)N(C(C)C)C1 |
| InChI | InChI=1S/C22H33NO4/c1-15(2)13-26-19-11-20(23(12-19)16(3)4)21(24)17(5)22(25)27-14-18-9-7-6-8-10-18/h6-10,15-17,19-20H,11-14H2,1-5H3/t17?,19-,20-/m0/s1 |
| InChIKey | PFRHMIIJPKHXTB-MFUMQWNRSA-N |
| XLogP | 3.46 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze benzyl 2-methyl-3-[(2S,4S)-4-(2-methylpropoxy)-1-propan-2-ylpyrrolidin-2-yl]-3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-methyl-3-[(2S,4S)-4-(2-methylpropoxy)-1-propan-2-ylpyrrolidin-2-yl]-3-oxopropanoate?
The IUPAC name of benzyl 2-methyl-3-[(2S,4S)-4-(2-methylpropoxy)-1-propan-2-ylpyrrolidin-2-yl]-3-oxopropanoate (CID 134582597) is benzyl 2-methyl-3-[(2S,4S)-4-(2-methylpropoxy)-1-propan-2-ylpyrrolidin-2-yl]-3-oxopropanoate.
What is the SMILES notation for benzyl 2-methyl-3-[(2S,4S)-4-(2-methylpropoxy)-1-propan-2-ylpyrrolidin-2-yl]-3-oxopropanoate?
The canonical SMILES for benzyl 2-methyl-3-[(2S,4S)-4-(2-methylpropoxy)-1-propan-2-ylpyrrolidin-2-yl]-3-oxopropanoate is CC(C)CO[C@H]1C[C@@H](C(=O)C(C)C(=O)OCc2ccccc2)N(C(C)C)C1.
What is the InChIKey of benzyl 2-methyl-3-[(2S,4S)-4-(2-methylpropoxy)-1-propan-2-ylpyrrolidin-2-yl]-3-oxopropanoate?
The InChIKey is PFRHMIIJPKHXTB-MFUMQWNRSA-N. The full InChI is InChI=1S/C22H33NO4/c1-15(2)13-26-19-11-20(23(12-19)16(3)4)21(24)17(5)22(25)27-14-18-9-7-6-8-10-18/h6-10,15-17,19-20H,11-14H2,1-5H3/t17?,19-,20-/m0/s1.
What are the key properties of benzyl 2-methyl-3-[(2S,4S)-4-(2-methylpropoxy)-1-propan-2-ylpyrrolidin-2-yl]-3-oxopropanoate?
benzyl 2-methyl-3-[(2S,4S)-4-(2-methylpropoxy)-1-propan-2-ylpyrrolidin-2-yl]-3-oxopropanoate has a molecular weight of 375.51 g/mol, XLogP of 3.46, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-methyl-3-[(2S,4S)-4-(2-methylpropoxy)-1-propan-2-ylpyrrolidin-2-yl]-3-oxopropanoate is sourced from PubChem (CID 134582597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).