C12H18O3 — CID 134582886
spiro[1,3-dioxolane-2,7'-3,4,4a,5,6,8-hexahydro-2H-naphthalene]-2'-ol (PubChem CID 134582886) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is spiro[1,3-dioxolane-2,7'-3,4,4a,5,6,8-hexahydro-2H-naphthalene]-2'-ol.
| Compound Name | spiro[1,3-dioxolane-2,7'-3,4,4a,5,6,8-hexahydro-2H-naphthalene]-2'-ol |
|---|---|
| PubChem CID | 134582886 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | spiro[1,3-dioxolane-2,7'-3,4,4a,5,6,8-hexahydro-2H-naphthalene]-2'-ol |
| SMILES | OC1C=C2CC3(CCC2CC1)OCCO3 |
| InChI | InChI=1S/C12H18O3/c13-11-2-1-9-3-4-12(8-10(9)7-11)14-5-6-15-12/h7,9,11,13H,1-6,8H2 |
| InChIKey | WUTBXDCNJXGKKZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|