C25H31NO4 — CID 134583329
methyl 2-[5-[2-(2-cyclohex-2-en-1-yl-1,3-oxazol-4-yl)ethoxy]-2,3-dihydro-1H-inden-1-yl]butanoate (PubChem CID 134583329) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is methyl 2-[5-[2-(2-cyclohex-2-en-1-yl-1,3-oxazol-4-yl)ethoxy]-2,3-dihydro-1H-inden-1-yl]butanoate.
| Compound Name | methyl 2-[5-[2-(2-cyclohex-2-en-1-yl-1,3-oxazol-4-yl)ethoxy]-2,3-dihydro-1H-inden-1-yl]butanoate |
|---|---|
| PubChem CID | 134583329 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | methyl 2-[5-[2-(2-cyclohex-2-en-1-yl-1,3-oxazol-4-yl)ethoxy]-2,3-dihydro-1H-inden-1-yl]butanoate |
| SMILES | CCC(C(=O)OC)C1CCc2cc(OCCc3coc(C4C=CCCC4)n3)ccc21 |
| InChI | InChI=1S/C25H31NO4/c1-3-21(25(27)28-2)23-11-9-18-15-20(10-12-22(18)23)29-14-13-19-16-30-24(26-19)17-7-5-4-6-8-17/h5,7,10,12,15-17,21,23H,3-4,6,8-9,11,13-14H2,1-2H3 |
| InChIKey | OUBOPRAZPLIGIP-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|