C36H33F — CID 134583404
1,4-bis[(1Z)-buta-1,3-dienyl]-2,3,3',5'-tetrakis(ethenyl)-2'-[(1E)-2-fluorobuta-1,3-dienyl]-4'-[(Z)-prop-1-enyl]spiro[cyclopenta-1,3-diene-5,1'-indene] (PubChem CID 134583404) has the molecular formula C36H33F and a molecular weight of 484.66 g/mol. Its IUPAC name is 1,4-bis[(1Z)-buta-1,3-dienyl]-2,3,3',5'-tetrakis(ethenyl)-2'-[(1E)-2-fluorobuta-1,3-dienyl]-4'-[(Z)-prop-1-enyl]spiro[cyclopenta-1,3-diene-5,1'-indene].
| Compound Name | 1,4-bis[(1Z)-buta-1,3-dienyl]-2,3,3',5'-tetrakis(ethenyl)-2'-[(1E)-2-fluorobuta-1,3-dienyl]-4'-[(Z)-prop-1-enyl]spiro[cyclopenta-1,3-diene-5,1'-indene] |
|---|---|
| PubChem CID | 134583404 |
| Molecular Formula | C36H33F |
| Molecular Weight | 484.66 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | 1,4-bis[(1Z)-buta-1,3-dienyl]-2,3,3',5'-tetrakis(ethenyl)-2'-[(1E)-2-fluorobuta-1,3-dienyl]-4'-[(Z)-prop-1-enyl]spiro[cyclopenta-1,3-diene-5,1'-indene] |
| SMILES | C=C/C=C\C1=C(C=C)C(C=C)=C(/C=C\C=C)C12C(/C=C(/F)C=C)=C(C=C)c1c2ccc(C=C)c1/C=C\C |
| InChI | InChI=1S/C36H33F/c1-9-17-20-31-27(14-6)28(15-7)32(21-18-10-2)36(31)33-23-22-25(12-4)30(19-11-3)35(33)29(16-8)34(36)24-26(37)13-5/h9-24H,1-2,4-8H2,3H3/b19-11-,20-17-,21-18-,26-24+ |
| InChIKey | RQTQEIIEYBLDMN-HBXXAKDBSA-N |
| XLogP | 10.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.66 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|