About [4-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-phenylmethanone
[4-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-phenylmethanone (PubChem CID 13458368) has the molecular formula C19H16F6N2O3S
and a molecular weight of 466.40 g/mol. Its IUPAC name is [4-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-phenylmethanone.
Molecular Properties
| Compound Name | [4-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-phenylmethanone |
| PubChem CID | 13458368 |
| Molecular Formula | C19H16F6N2O3S |
| Molecular Weight | 466.40 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | [4-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCN(S(=O)(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H16F6N2O3S/c20-18(21,22)14-10-15(19(23,24)25)12-16(11-14)31(29,30)27-8-6-26(7-9-27)17(28)13-4-2-1-3-5-13/h1-5,10-12H,6-9H2 |
| InChIKey | PIYWKJKVVMSCGG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-phenylmethanone?
The IUPAC name of [4-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-phenylmethanone (CID 13458368) is [4-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-phenylmethanone.
What is the SMILES notation for [4-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-phenylmethanone?
The canonical SMILES for [4-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-phenylmethanone is O=C(c1ccccc1)N1CCN(S(=O)(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC1.
What is the InChIKey of [4-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-phenylmethanone?
The InChIKey is PIYWKJKVVMSCGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16F6N2O3S/c20-18(21,22)14-10-15(19(23,24)25)12-16(11-14)31(29,30)27-8-6-26(7-9-27)17(28)13-4-2-1-3-5-13/h1-5,10-12H,6-9H2.
What are the key properties of [4-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-phenylmethanone?
[4-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-phenylmethanone has a molecular weight of 466.40 g/mol, XLogP of 3.87, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-phenylmethanone is sourced from PubChem (CID 13458368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).