C22H21F5N4O3 — CID 134584089
4,4-difluoro-N-phenyl-N-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]piperidine-1-carboxamide (PubChem CID 134584089) has the molecular formula C22H21F5N4O3 and a molecular weight of 484.43 g/mol. Its IUPAC name is 4,4-difluoro-N-phenyl-N-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]piperidine-1-carboxamide.
| Compound Name | 4,4-difluoro-N-phenyl-N-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 134584089 |
| Molecular Formula | C22H21F5N4O3 |
| Molecular Weight | 484.43 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 4,4-difluoro-N-phenyl-N-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]piperidine-1-carboxamide |
| SMILES | O=C(NNC(=O)C(F)(F)F)c1ccc(CN(C(=O)N2CCC(F)(F)CC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H21F5N4O3/c23-21(24)10-12-30(13-11-21)20(34)31(17-4-2-1-3-5-17)14-15-6-8-16(9-7-15)18(32)28-29-19(33)22(25,26)27/h1-9H,10-14H2,(H,28,32)(H,29,33) |
| InChIKey | FBYFUYQOGXXCMA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|